C21H19N3O2S — CID 8658929
1-(2,2-diphenylethyl)-3-(4-nitrophenyl)thiourea (PubChem CID 8658929) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-(2,2-diphenylethyl)-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8658929 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-(4-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)NCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c25-24(26)19-13-11-18(12-14-19)23-21(27)22-15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,20H,15H2,(H2,22,23,27) |
| InChIKey | MDJVOIZJMMLFJR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|