C19H24N4O2S — CID 8656435
1-[(2S)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(4-nitrophenyl)thiourea (PubChem CID 8656435) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8656435 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(4-nitrophenyl)thiourea |
| SMILES | CCc1ccc([C@@H](CNC(=S)Nc2ccc([N+](=O)[O-])cc2)N(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O2S/c1-4-14-5-7-15(8-6-14)18(22(2)3)13-20-19(26)21-16-9-11-17(12-10-16)23(24)25/h5-12,18H,4,13H2,1-3H3,(H2,20,21,26)/t18-/m1/s1 |
| InChIKey | IURDMNFFYKKMPR-GOSISDBHSA-N |
| XLogP | 3.75 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|