C15H25N4O2S+ — CID 8659731
2-[(4-nitrophenyl)carbamothioylamino]ethyl-di(propan-2-yl)azanium (PubChem CID 8659731) has the molecular formula C15H25N4O2S+ and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)carbamothioylamino]ethyl-di(propan-2-yl)azanium.
| Compound Name | 2-[(4-nitrophenyl)carbamothioylamino]ethyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 8659731 |
| Molecular Formula | C15H25N4O2S+ |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[(4-nitrophenyl)carbamothioylamino]ethyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](CCNC(=S)Nc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C15H24N4O2S/c1-11(2)18(12(3)4)10-9-16-15(22)17-13-5-7-14(8-6-13)19(20)21/h5-8,11-12H,9-10H2,1-4H3,(H2,16,17,22)/p+1 |
| InChIKey | ZPGNNEBRLCMBEV-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|