C11H15N3O3S — CID 8624708
1-[(2R)-1-hydroxybutan-2-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 8624708) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxybutan-2-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(2R)-1-hydroxybutan-2-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8624708 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[(2R)-1-hydroxybutan-2-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | CC[C@H](CO)NC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15N3O3S/c1-2-8(7-15)12-11(18)13-9-3-5-10(6-4-9)14(16)17/h3-6,8,15H,2,7H2,1H3,(H2,12,13,18)/t8-/m1/s1 |
| InChIKey | DLLOTJSICYTKCY-MRVPVSSYSA-N |
| XLogP | 1.65 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|