C19H23N3O2S — CID 7470196
1-[(1R)-1-[4-[(2R)-butan-2-yl]phenyl]ethyl]-3-(4-nitrophenyl)thiourea (PubChem CID 7470196) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[(1R)-1-[4-[(2R)-butan-2-yl]phenyl]ethyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(1R)-1-[4-[(2R)-butan-2-yl]phenyl]ethyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 7470196 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[(1R)-1-[4-[(2R)-butan-2-yl]phenyl]ethyl]-3-(4-nitrophenyl)thiourea |
| SMILES | CC[C@@H](C)c1ccc([C@@H](C)NC(=S)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H23N3O2S/c1-4-13(2)15-5-7-16(8-6-15)14(3)20-19(25)21-17-9-11-18(12-10-17)22(23)24/h5-14H,4H2,1-3H3,(H2,20,21,25)/t13-,14-/m1/s1 |
| InChIKey | UIEQZRZAYCAYME-ZIAGYGMSSA-N |
| XLogP | 5.16 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|