C17H21N4O2S+ — CID 8659697
dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-phenylethyl]azanium (PubChem CID 8659697) has the molecular formula C17H21N4O2S+ and a molecular weight of 345.45 g/mol. Its IUPAC name is dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-phenylethyl]azanium.
| Compound Name | dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8659697 |
| Molecular Formula | C17H21N4O2S+ |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-phenylethyl]azanium |
| SMILES | C[NH+](C)[C@H](CNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-20(2)16(13-6-4-3-5-7-13)12-18-17(24)19-14-8-10-15(11-9-14)21(22)23/h3-11,16H,12H2,1-2H3,(H2,18,19,24)/p+1/t16-/m1/s1 |
| InChIKey | TWXNAFIWKXYBHY-MRXNPFEDSA-O |
| XLogP | 1.77 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|