C18H22N4O3S — CID 8655053
1-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(4-nitrophenyl)thiourea (PubChem CID 8655053) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8655053 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(4-nitrophenyl)thiourea |
| SMILES | COc1ccccc1[C@@H](CNC(=S)Nc1ccc([N+](=O)[O-])cc1)N(C)C |
| InChI | InChI=1S/C18H22N4O3S/c1-21(2)16(15-6-4-5-7-17(15)25-3)12-19-18(26)20-13-8-10-14(11-9-13)22(23)24/h4-11,16H,12H2,1-3H3,(H2,19,20,26)/t16-/m1/s1 |
| InChIKey | XRXIUOPFIQVRKW-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|