C17H18ClFN4O2S — CID 8656820
1-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea (PubChem CID 8656820) has the molecular formula C17H18ClFN4O2S and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8656820 |
| Molecular Formula | C17H18ClFN4O2S |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea |
| SMILES | CN(C)[C@@H](CNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H18ClFN4O2S/c1-22(2)15(16-13(18)4-3-5-14(16)19)10-20-17(26)21-11-6-8-12(9-7-11)23(24)25/h3-9,15H,10H2,1-2H3,(H2,20,21,26)/t15-/m0/s1 |
| InChIKey | RAISRFNLZKXZQD-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|