C19H23ClFN3S — CID 8656813
1-[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 8656813) has the molecular formula C19H23ClFN3S and a molecular weight of 379.93 g/mol. Its IUPAC name is 1-[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8656813 |
| Molecular Formula | C19H23ClFN3S |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NC[C@H](c2c(F)cccc2Cl)N(C)C)c1 |
| InChI | InChI=1S/C19H23ClFN3S/c1-12-8-13(2)10-14(9-12)23-19(25)22-11-17(24(3)4)18-15(20)6-5-7-16(18)21/h5-10,17H,11H2,1-4H3,(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | PLDYXJUJAWSHDU-QGZVFWFLSA-N |
| XLogP | 4.69 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|