C15H18ClN3OS — CID 4837057
1-(2-chlorophenyl)-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]thiourea (PubChem CID 4837057) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 4837057 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]thiourea |
| SMILES | CN(C)C(CNC(=S)Nc1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-19(2)13(14-8-5-9-20-14)10-17-15(21)18-12-7-4-3-6-11(12)16/h3-9,13H,10H2,1-2H3,(H2,17,18,21) |
| InChIKey | XNSLKRFVYYWCDM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|