C17H23N3OS — CID 7945101
1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 7945101) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7945101 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC[C@H](c2ccco2)N(C)C)cc1C |
| InChI | InChI=1S/C17H23N3OS/c1-12-7-8-14(10-13(12)2)19-17(22)18-11-15(20(3)4)16-6-5-9-21-16/h5-10,15H,11H2,1-4H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | UEVMEHYOZGPDAE-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|