C15H18N4OS2 — CID 8618168
1-(3,4-dimethylphenyl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea (PubChem CID 8618168) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8618168 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=S)NCc2ccco2)cc1C |
| InChI | InChI=1S/C15H18N4OS2/c1-10-5-6-12(8-11(10)2)17-15(22)19-18-14(21)16-9-13-4-3-7-20-13/h3-8H,9H2,1-2H3,(H2,16,18,21)(H2,17,19,22) |
| InChIKey | ACEWJJIMXWMCGG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|