C16H22N4OS2 — CID 163670813
1-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea;thiourea (PubChem CID 163670813) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea;thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea;thiourea |
|---|---|
| PubChem CID | 163670813 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea;thiourea |
| SMILES | Cc1cc(C)c(NC(=S)NCc2ccco2)c(C)c1.NC(N)=S |
| InChI | InChI=1S/C15H18N2OS.CH4N2S/c1-10-7-11(2)14(12(3)8-10)17-15(19)16-9-13-5-4-6-18-13;2-1(3)4/h4-8H,9H2,1-3H3,(H2,16,17,19);(H4,2,3,4) |
| InChIKey | JCJCFJISOQJSST-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|