C18H21ClN2O3 — CID 108961418
N-(2-chloro-4,6-dimethylphenyl)-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide (PubChem CID 108961418) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108961418 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)(C)C(=O)NCc2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-11-8-12(2)15(14(19)9-11)21-17(23)18(3,4)16(22)20-10-13-6-5-7-24-13/h5-9H,10H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | SKALTZIKGYATNS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|