C15H14ClNO2 — CID 2673717
(E)-N-(2-chloro-4,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 2673717) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2673717 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C=C/c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClNO2/c1-10-8-11(2)15(13(16)9-10)17-14(18)6-5-12-4-3-7-19-12/h3-9H,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | FECKSHJPLBDGQS-AATRIKPKSA-N |
| XLogP | 4.20 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|