C15H14BrNO2 — CID 880816
N-(4-bromo-2,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 880816) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 880816 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C15H14BrNO2/c1-10-8-12(16)9-11(2)15(10)17-14(18)6-5-13-4-3-7-19-13/h3-9H,1-2H3,(H,17,18) |
| InChIKey | UDWSALCRGBKJPK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|