C16H14Br2N2O4 — CID 4505545
N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide (PubChem CID 4505545) has the molecular formula C16H14Br2N2O4 and a molecular weight of 458.11 g/mol. Its IUPAC name is N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide.
| Compound Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 4505545 |
| Molecular Formula | C16H14Br2N2O4 |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C16H14Br2N2O4/c1-10-7-11(17)8-13(18)16(10)24-9-15(22)20-19-14(21)5-4-12-3-2-6-23-12/h2-8H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | AFGCIUZPEPTGIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|