C17H17ClN2O4 — CID 6123131
(E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide (PubChem CID 6123131) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 6123131 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(furan-2-yl)prop-2-enehydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)/C=C/c2ccco2)cc(C)c1Cl |
| InChI | InChI=1S/C17H17ClN2O4/c1-11-8-14(9-12(2)17(11)18)24-10-16(22)20-19-15(21)6-5-13-4-3-7-23-13/h3-9H,10H2,1-2H3,(H,19,21)(H,20,22)/b6-5+ |
| InChIKey | BUMVXLNYQKPWJI-AATRIKPKSA-N |
| XLogP | 2.79 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|