C16H15NO5 — CID 17362080
2-[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylphenoxy]acetic acid (PubChem CID 17362080) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 17362080 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C16H15NO5/c1-11-9-13(22-10-16(19)20)4-6-14(11)17-15(18)7-5-12-3-2-8-21-12/h2-9H,10H2,1H3,(H,17,18)(H,19,20)/b7-5+ |
| InChIKey | QAZQZOFGSWVYMA-FNORWQNLSA-N |
| XLogP | 2.70 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|