C16H17ClN2O3 — CID 5419184
2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide (PubChem CID 5419184) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 5419184 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)COc1cc(C)c(Cl)c(C)c1)c1ccco1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-10-7-13(8-11(2)16(10)17)22-9-15(20)19-18-12(3)14-5-4-6-21-14/h4-8H,9H2,1-3H3,(H,19,20)/b18-12+ |
| InChIKey | LWHYXNWUBCBAGI-LDADJPATSA-N |
| XLogP | 3.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|