C14H11Br3N2O3 — CID 6248098
N-[(E)-1-(furan-2-yl)ethylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 6248098) has the molecular formula C14H11Br3N2O3 and a molecular weight of 494.97 g/mol. Its IUPAC name is N-[(E)-1-(furan-2-yl)ethylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-1-(furan-2-yl)ethylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 6248098 |
| Molecular Formula | C14H11Br3N2O3 |
| Molecular Weight | 494.97 g/mol |
| Exact Mass | 491.83 |
| IUPAC Name | N-[(E)-1-(furan-2-yl)ethylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | C/C(=N\NC(=O)COc1c(Br)cc(Br)cc1Br)c1ccco1 |
| InChI | InChI=1S/C14H11Br3N2O3/c1-8(12-3-2-4-21-12)18-19-13(20)7-22-14-10(16)5-9(15)6-11(14)17/h2-6H,7H2,1H3,(H,19,20)/b18-8+ |
| InChIKey | BYPWLHSZFDKPQR-QGMBQPNBSA-N |
| XLogP | 4.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|