C20H19ClFN3O3S — CID 6123646
(E)-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 6123646) has the molecular formula C20H19ClFN3O3S and a molecular weight of 435.91 g/mol. Its IUPAC name is (E)-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6123646 |
| Molecular Formula | C20H19ClFN3O3S |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (E)-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cc(OCC(=O)NNC(=S)NC(=O)/C=C/c2ccc(F)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C20H19ClFN3O3S/c1-12-9-16(10-13(2)19(12)21)28-11-18(27)24-25-20(29)23-17(26)8-5-14-3-6-15(22)7-4-14/h3-10H,11H2,1-2H3,(H,24,27)(H2,23,25,26,29)/b8-5+ |
| InChIKey | YDYFOXJCNKWICB-VMPITWQZSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|