C18H17ClFN3O3S — CID 4950468
N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-fluorobenzamide (PubChem CID 4950468) has the molecular formula C18H17ClFN3O3S and a molecular weight of 409.87 g/mol. Its IUPAC name is N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4950468 |
| Molecular Formula | C18H17ClFN3O3S |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-fluorobenzamide |
| SMILES | Cc1cc(OCC(=O)NNC(=S)NC(=O)c2ccccc2F)cc(C)c1Cl |
| InChI | InChI=1S/C18H17ClFN3O3S/c1-10-7-12(8-11(2)16(10)19)26-9-15(24)22-23-18(27)21-17(25)13-5-3-4-6-14(13)20/h3-8H,9H2,1-2H3,(H,22,24)(H2,21,23,25,27) |
| InChIKey | XZHDXPWRKPBQBY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|