C21H23BrClN3O4S — CID 17052094
5-bromo-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide (PubChem CID 17052094) has the molecular formula C21H23BrClN3O4S and a molecular weight of 528.86 g/mol. Its IUPAC name is 5-bromo-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide.
| Compound Name | 5-bromo-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17052094 |
| Molecular Formula | C21H23BrClN3O4S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 5-bromo-N-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide |
| SMILES | Cc1cc(OCC(=O)NNC(=S)NC(=O)c2cc(Br)ccc2OC(C)C)cc(C)c1Cl |
| InChI | InChI=1S/C21H23BrClN3O4S/c1-11(2)30-17-6-5-14(22)9-16(17)20(28)24-21(31)26-25-18(27)10-29-15-7-12(3)19(23)13(4)8-15/h5-9,11H,10H2,1-4H3,(H,25,27)(H2,24,26,28,31) |
| InChIKey | HZLKQAJYHKEIAN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|