C19H18ClN3O5 — CID 17187002
(E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(4-nitrophenyl)prop-2-enehydrazide (PubChem CID 17187002) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(4-nitrophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(4-nitrophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 17187002 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (E)-N'-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-3-(4-nitrophenyl)prop-2-enehydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc(C)c1Cl |
| InChI | InChI=1S/C19H18ClN3O5/c1-12-9-16(10-13(2)19(12)20)28-11-18(25)22-21-17(24)8-5-14-3-6-15(7-4-14)23(26)27/h3-10H,11H2,1-2H3,(H,21,24)(H,22,25)/b8-5+ |
| InChIKey | CJAKARHHXCBERP-VMPITWQZSA-N |
| XLogP | 3.10 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|