C19H19BrN2O3 — CID 6121079
(E)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide (PubChem CID 6121079) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is (E)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 6121079 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (E)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)COc2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C19H19BrN2O3/c1-13-3-5-15(6-4-13)7-10-18(23)21-22-19(24)12-25-16-8-9-17(20)14(2)11-16/h3-11H,12H2,1-2H3,(H,21,23)(H,22,24)/b10-7+ |
| InChIKey | BMNAIHDIWXQWAJ-JXMROGBWSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|