C20H20Br2N2O4 — CID 17227271
(E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-ethoxyphenyl)prop-2-enehydrazide (PubChem CID 17227271) has the molecular formula C20H20Br2N2O4 and a molecular weight of 512.20 g/mol. Its IUPAC name is (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-ethoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-ethoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 17227271 |
| Molecular Formula | C20H20Br2N2O4 |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-ethoxyphenyl)prop-2-enehydrazide |
| SMILES | CCOc1ccc(/C=C/C(=O)NNC(=O)COc2c(C)cc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C20H20Br2N2O4/c1-3-27-16-7-4-14(5-8-16)6-9-18(25)23-24-19(26)12-28-20-13(2)10-15(21)11-17(20)22/h4-11H,3,12H2,1-2H3,(H,23,25)(H,24,26)/b9-6+ |
| InChIKey | GNCWQMCBQPYFBA-RMKNXTFCSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|