C22H26N2O4 — CID 17227225
(E)-3-(4-ethoxyphenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 17227225) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 17227225 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | CCOc1ccc(/C=C/C(=O)NNC(=O)COc2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-4-27-18-12-9-17(10-13-18)11-14-21(25)23-24-22(26)15-28-20-8-6-5-7-19(20)16(2)3/h5-14,16H,4,15H2,1-3H3,(H,23,25)(H,24,26)/b14-11+ |
| InChIKey | JYJWPAWCFZMRKR-SDNWHVSQSA-N |
| XLogP | 3.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|