C20H21N3O5 — CID 17176076
(E)-3-(3-nitrophenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 17176076) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(3-nitrophenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 17176076 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N'-[2-(2-propan-2-ylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | CC(C)c1ccccc1OCC(=O)NNC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O5/c1-14(2)17-8-3-4-9-18(17)28-13-20(25)22-21-19(24)11-10-15-6-5-7-16(12-15)23(26)27/h3-12,14H,13H2,1-2H3,(H,21,24)(H,22,25)/b11-10+ |
| InChIKey | GAEHMOKGLXDVGF-ZHACJKMWSA-N |
| XLogP | 2.96 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|