C19H17BrN4O5S — CID 17176414
(E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17176414) has the molecular formula C19H17BrN4O5S and a molecular weight of 493.34 g/mol. Its IUPAC name is (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17176414 |
| Molecular Formula | C19H17BrN4O5S |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=S)NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C19H17BrN4O5S/c1-12-5-7-16(15(20)9-12)29-11-18(26)22-23-19(30)21-17(25)8-6-13-3-2-4-14(10-13)24(27)28/h2-10H,11H2,1H3,(H,22,26)(H2,21,23,25,30)/b8-6+ |
| InChIKey | PELVQTLFTLUGAW-SOFGYWHQSA-N |
| XLogP | 2.78 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|