C18H18BrN3O4S — CID 6295518
(E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 6295518) has the molecular formula C18H18BrN3O4S and a molecular weight of 452.33 g/mol. Its IUPAC name is (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6295518 |
| Molecular Formula | C18H18BrN3O4S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | (E)-N-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=S)NC(=O)/C=C/c2ccc(C)o2)c(Br)c1 |
| InChI | InChI=1S/C18H18BrN3O4S/c1-11-3-7-15(14(19)9-11)25-10-17(24)21-22-18(27)20-16(23)8-6-13-5-4-12(2)26-13/h3-9H,10H2,1-2H3,(H,21,24)(H2,20,22,23,27)/b8-6+ |
| InChIKey | XFKWVFGHLACXRV-SOFGYWHQSA-N |
| XLogP | 2.77 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|