C18H15Br2ClN2O3 — CID 6133360
(E)-3-(2-chlorophenyl)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 6133360) has the molecular formula C18H15Br2ClN2O3 and a molecular weight of 502.59 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(2-chlorophenyl)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 6133360 |
| Molecular Formula | C18H15Br2ClN2O3 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 499.91 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C18H15Br2ClN2O3/c1-11-8-13(19)9-14(20)18(11)26-10-17(25)23-22-16(24)7-6-12-4-2-3-5-15(12)21/h2-9H,10H2,1H3,(H,22,24)(H,23,25)/b7-6+ |
| InChIKey | KRDDXJXJYVNGAE-VOTSOKGWSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|