C19H18Br2N2O3 — CID 6121077
(E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide (PubChem CID 6121077) has the molecular formula C19H18Br2N2O3 and a molecular weight of 482.17 g/mol. Its IUPAC name is (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 6121077 |
| Molecular Formula | C19H18Br2N2O3 |
| Molecular Weight | 482.17 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | (E)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-3-(4-methylphenyl)prop-2-enehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)COc2c(C)cc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C19H18Br2N2O3/c1-12-3-5-14(6-4-12)7-8-17(24)22-23-18(25)11-26-19-13(2)9-15(20)10-16(19)21/h3-10H,11H2,1-2H3,(H,22,24)(H,23,25)/b8-7+ |
| InChIKey | NPTCYCFVVOMGBL-BQYQJAHWSA-N |
| XLogP | 4.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.17 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|