C12H16N2O4 — CID 4876281
tert-butyl N-[3-(furan-2-yl)prop-2-enoylamino]carbamate (PubChem CID 4876281) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is tert-butyl N-[3-(furan-2-yl)prop-2-enoylamino]carbamate.
| Compound Name | tert-butyl N-[3-(furan-2-yl)prop-2-enoylamino]carbamate |
|---|---|
| PubChem CID | 4876281 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | tert-butyl N-[3-(furan-2-yl)prop-2-enoylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C12H16N2O4/c1-12(2,3)18-11(16)14-13-10(15)7-6-9-5-4-8-17-9/h4-8H,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | IVFASNRIBUDRSS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|