C15H14N2O4 — CID 922444
N'-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-methoxybenzohydrazide (PubChem CID 922444) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is N'-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 922444 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N'-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C15H14N2O4/c1-20-12-6-4-11(5-7-12)15(19)17-16-14(18)9-8-13-3-2-10-21-13/h2-10H,1H3,(H,16,18)(H,17,19)/b9-8+ |
| InChIKey | GAROYQZGDIUCPZ-CMDGGOBGSA-N |
| XLogP | 1.76 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|