C16H16N2O3 — CID 78537225
4-ethyl-N'-[3-(furan-2-yl)prop-2-enoyl]benzohydrazide (PubChem CID 78537225) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-ethyl-N'-[3-(furan-2-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[3-(furan-2-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 78537225 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-ethyl-N'-[3-(furan-2-yl)prop-2-enoyl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-12-5-7-13(8-6-12)16(20)18-17-15(19)10-9-14-4-3-11-21-14/h3-11H,2H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | LFCMTCZOJPQOJI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|