C11H13NO3S — CID 102351235
O-propan-2-yl N-[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioate (PubChem CID 102351235) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is O-propan-2-yl N-[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioate.
| Compound Name | O-propan-2-yl N-[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioate |
|---|---|
| PubChem CID | 102351235 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | O-propan-2-yl N-[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioate |
| SMILES | CC(C)OC(=S)NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C11H13NO3S/c1-8(2)15-11(16)12-10(13)6-5-9-4-3-7-14-9/h3-8H,1-2H3,(H,12,13,16)/b6-5+ |
| InChIKey | IPMVYPOUPUUFCZ-AATRIKPKSA-N |
| XLogP | 2.12 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|