C11H15NO3 — CID 75619467
3-(furan-2-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide (PubChem CID 75619467) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75619467 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-(furan-2-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide |
| SMILES | COCC(C)NC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C11H15NO3/c1-9(8-14-2)12-11(13)6-5-10-4-3-7-15-10/h3-7,9H,8H2,1-2H3,(H,12,13) |
| InChIKey | FXNTWYPNUQNGIZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|