C22H19N3O3S — CID 6134777
(E)-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 6134777) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is (E)-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6134777 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (E)-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c26-19(14-13-18-12-7-15-28-18)23-22(29)25-24-21(27)20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-15,20H,(H,24,27)(H2,23,25,26,29)/b14-13+ |
| InChIKey | DBLQNXSJICOIRF-BUHFOSPRSA-N |
| XLogP | 3.15 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|