C19H21NO4 — CID 46637717
propan-2-yl 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 46637717) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46637717 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)/C=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c1-14(2)24-19(22)13-17(15-7-4-3-5-8-15)20-18(21)11-10-16-9-6-12-23-16/h3-12,14,17H,13H2,1-2H3,(H,20,21)/b11-10+ |
| InChIKey | KYKBVEIGBLVYJN-ZHACJKMWSA-N |
| XLogP | 3.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|