C27H23NO2 — CID 6057021
(E)-3-(furan-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]prop-2-enamide (PubChem CID 6057021) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 6057021 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23NO2/c29-27(18-17-25-12-7-19-30-25)28-26(20-21-8-3-1-4-9-21)24-15-13-23(14-16-24)22-10-5-2-6-11-22/h1-19,26H,20H2,(H,28,29)/b18-17+ |
| InChIKey | CYHUJBCVEYLXBA-ISLYRVAYSA-N |
| XLogP | 6.06 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|