C22H19NO4 — CID 59752804
3-(furan-2-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 59752804) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-(furan-2-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59752804 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-(furan-2-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)/C=C/c1ccc(-c2ccccc2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H19NO4/c24-21(23-19(15-22(25)26)20-7-4-14-27-20)13-10-16-8-11-18(12-9-16)17-5-2-1-3-6-17/h1-14,19H,15H2,(H,23,24)(H,25,26)/b13-10+ |
| InChIKey | QCILCOZGBYXMLR-JLHYYAGUSA-N |
| XLogP | 4.29 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|