C27H27NO2 — CID 89378134
(3E)-N-[3-cyclopropylidene-1-(furan-2-yl)-3-methoxypropyl]-4-(4-phenylphenyl)buta-1,3-dien-2-amine (PubChem CID 89378134) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (3E)-N-[3-cyclopropylidene-1-(furan-2-yl)-3-methoxypropyl]-4-(4-phenylphenyl)buta-1,3-dien-2-amine.
| Compound Name | (3E)-N-[3-cyclopropylidene-1-(furan-2-yl)-3-methoxypropyl]-4-(4-phenylphenyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 89378134 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (3E)-N-[3-cyclopropylidene-1-(furan-2-yl)-3-methoxypropyl]-4-(4-phenylphenyl)buta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/c1ccc(-c2ccccc2)cc1)NC(CC(OC)=C1CC1)c1ccco1 |
| InChI | InChI=1S/C27H27NO2/c1-20(10-11-21-12-14-23(15-13-21)22-7-4-3-5-8-22)28-25(26-9-6-18-30-26)19-27(29-2)24-16-17-24/h3-15,18,25,28H,1,16-17,19H2,2H3/b11-10+ |
| InChIKey | AWQLMAYXURBDKN-ZHACJKMWSA-N |
| XLogP | 6.89 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|