C19H22OSi — CID 85401954
trimethyl-[4-(4-phenylphenyl)buta-1,3-dien-2-yloxy]silane (PubChem CID 85401954) has the molecular formula C19H22OSi and a molecular weight of 294.47 g/mol. Its IUPAC name is trimethyl-[4-(4-phenylphenyl)buta-1,3-dien-2-yloxy]silane.
| Compound Name | trimethyl-[4-(4-phenylphenyl)buta-1,3-dien-2-yloxy]silane |
|---|---|
| PubChem CID | 85401954 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | trimethyl-[4-(4-phenylphenyl)buta-1,3-dien-2-yloxy]silane |
| SMILES | C=C(C=Cc1ccc(-c2ccccc2)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C19H22OSi/c1-16(20-21(2,3)4)10-11-17-12-14-19(15-13-17)18-8-6-5-7-9-18/h5-15H,1H2,2-4H3 |
| InChIKey | HBOBOUMZIISRPR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|