About 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol
4-[(1E)-3-methoxybuta-1,3-dienyl]phenol (PubChem CID 144568960) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol.
Molecular Properties
| Compound Name | 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol |
| PubChem CID | 144568960 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol |
| SMILES | C=C(/C=C/c1ccc(O)cc1)OC |
| InChI | InChI=1S/C11H12O2/c1-9(13-2)3-4-10-5-7-11(12)8-6-10/h3-8,12H,1H2,2H3/b4-3+ |
| InChIKey | JOMJBSRNGPFJLY-ONEGZZNKSA-N |
| XLogP | 2.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol?
The IUPAC name of 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol (CID 144568960) is 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol.
What is the SMILES notation for 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol?
The canonical SMILES for 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol is C=C(/C=C/c1ccc(O)cc1)OC.
What is the InChIKey of 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol?
The InChIKey is JOMJBSRNGPFJLY-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12O2/c1-9(13-2)3-4-10-5-7-11(12)8-6-10/h3-8,12H,1H2,2H3/b4-3+.
What are the key properties of 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol?
4-[(1E)-3-methoxybuta-1,3-dienyl]phenol has a molecular weight of 176.21 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol is sourced from PubChem (CID 144568960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).