C11H12O2 — CID 144568960
4-[(1E)-3-methoxybuta-1,3-dienyl]phenol (PubChem CID 144568960) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol.
| Compound Name | 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 144568960 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-[(1E)-3-methoxybuta-1,3-dienyl]phenol |
| SMILES | C=C(/C=C/c1ccc(O)cc1)OC |
| InChI | InChI=1S/C11H12O2/c1-9(13-2)3-4-10-5-7-11(12)8-6-10/h3-8,12H,1H2,2H3/b4-3+ |
| InChIKey | JOMJBSRNGPFJLY-ONEGZZNKSA-N |
| XLogP | 2.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|