C14H17FO — CID 137491088
1-fluoro-4-[(1E)-3-[(2-methylpropan-2-yl)oxy]buta-1,3-dienyl]benzene (PubChem CID 137491088) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-fluoro-4-[(1E)-3-[(2-methylpropan-2-yl)oxy]buta-1,3-dienyl]benzene.
| Compound Name | 1-fluoro-4-[(1E)-3-[(2-methylpropan-2-yl)oxy]buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 137491088 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-fluoro-4-[(1E)-3-[(2-methylpropan-2-yl)oxy]buta-1,3-dienyl]benzene |
| SMILES | C=C(/C=C/c1ccc(F)cc1)OC(C)(C)C |
| InChI | InChI=1S/C14H17FO/c1-11(16-14(2,3)4)5-6-12-7-9-13(15)10-8-12/h5-10H,1H2,2-4H3/b6-5+ |
| InChIKey | GGJQTVYIRUKDMJ-AATRIKPKSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|