About CID 145203417
CID 145203417 (PubChem CID 145203417) has the molecular formula C8H7BFO
and a molecular weight of 148.95 g/mol.
Molecular Properties
| Compound Name | CID 145203417 |
| PubChem CID | 145203417 |
| Molecular Formula | C8H7BFO |
| Molecular Weight | 148.95 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | — |
| SMILES | O[B]/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C8H7BFO/c10-8-3-1-7(2-4-8)5-6-9-11/h1-6,11H/b6-5+ |
| InChIKey | NACPMORTRCWJBJ-AATRIKPKSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.95 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145203417 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145203417?
The IUPAC name of CID 145203417 (CID 145203417) is not available.
What is the SMILES notation for CID 145203417?
The canonical SMILES for CID 145203417 is O[B]/C=C/c1ccc(F)cc1.
What is the InChIKey of CID 145203417?
The InChIKey is NACPMORTRCWJBJ-AATRIKPKSA-N. The full InChI is InChI=1S/C8H7BFO/c10-8-3-1-7(2-4-8)5-6-9-11/h1-6,11H/b6-5+.
What are the key properties of CID 145203417?
CID 145203417 has a molecular weight of 148.95 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145203417 is sourced from PubChem (CID 145203417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).