C11H12O2 — CID 144837467
4-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]phenol (PubChem CID 144837467) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 4-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]phenol.
| Compound Name | 4-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 144837467 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]phenol |
| SMILES | C/C=C(O)\C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C11H12O2/c1-2-10(12)6-3-9-4-7-11(13)8-5-9/h2-8,12-13H,1H3/b6-3-,10-2+ |
| InChIKey | FQFVPZRFEUHZSB-ZGRBTRKNSA-N |
| XLogP | 2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|