C13H14O2 — CID 88956129
4-[(1E,3E,5Z)-4-hydroxyhepta-1,3,5-trienyl]phenol (PubChem CID 88956129) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-[(1E,3E,5Z)-4-hydroxyhepta-1,3,5-trienyl]phenol.
| Compound Name | 4-[(1E,3E,5Z)-4-hydroxyhepta-1,3,5-trienyl]phenol |
|---|---|
| PubChem CID | 88956129 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-[(1E,3E,5Z)-4-hydroxyhepta-1,3,5-trienyl]phenol |
| SMILES | C/C=C\C(O)=C/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C13H14O2/c1-2-4-12(14)6-3-5-11-7-9-13(15)10-8-11/h2-10,14-15H,1H3/b4-2-,5-3+,12-6+ |
| InChIKey | XZXSOECWYODMHO-KZJPXWPMSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|