C34H36O2 — CID 76584556
4-[18-(4-hydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]phenol (PubChem CID 76584556) has the molecular formula C34H36O2 and a molecular weight of 476.66 g/mol. Its IUPAC name is 4-[18-(4-hydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]phenol.
| Compound Name | 4-[18-(4-hydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]phenol |
|---|---|
| PubChem CID | 76584556 |
| Molecular Formula | C34H36O2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 4-[18-(4-hydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]phenol |
| SMILES | CC(C=CC=C(C)C=Cc1ccc(O)cc1)=CC=CC=C(C)C=CC=C(C)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C34H36O2/c1-27(11-7-13-29(3)15-17-31-19-23-33(35)24-20-31)9-5-6-10-28(2)12-8-14-30(4)16-18-32-21-25-34(36)26-22-32/h5-26,35-36H,1-4H3 |
| InChIKey | KJQWMNWCYDZEBB-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|